|
CAS#: 68163-03-1 Product: Valorphin No suppilers available for the product. |
| Name | Valorphin |
|---|---|
| Synonyms | 4-(2-(2-Chlorophenyl)Ethyl)Amino-8-Methoxy-3,10-Dimethyl-2,9-Dioxatricyclo(4,3,1,0(3,7))Decane; Valorphin |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 |
| CAS Registry Number | 68163-03-1 |
| SMILES | [C@@H]13O[C@@H]([C@@H]2[C@H]([C@@H]1C)C[C@@H]([C@]2(O3)C)NCCC4=C(C=CC=C4)Cl)OC |
| InChI | 1S/C19H26ClNO3/c1-11-13-10-15(21-9-8-12-6-4-5-7-14(12)20)19(2)16(13)18(22-3)23-17(11)24-19/h4-7,11,13,15-18,21H,8-10H2,1-3H3/t11-,13-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | LEZRPUQAMHWLNN-PCVUGLTOSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.014°C at 760 mmHg (Cal.) |
| Flash point | 225.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Valorphin |