|
CAS#: 68171-35-7 Product: Diethyladipoyl Dichloride No suppilers available for the product. |
| Name | Diethyladipoyl Dichloride |
|---|---|
| Synonyms | 3,4-Diethyladipoyl Dichloride; Diethyladipoyl Dichloride; Diethylhexanedioyl Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16Cl2O2 |
| Molecular Weight | 239.14 |
| CAS Registry Number | 68171-35-7 |
| EINECS | 269-024-9 |
| SMILES | C(C(=O)Cl)C(C(CC(=O)Cl)CC)CC |
| InChI | 1S/C10H16Cl2O2/c1-3-7(5-9(11)13)8(4-2)6-10(12)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | PGDRDXPCUAMNCP-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.158°C at 760 mmHg (Cal.) |
| Flash point | 143.059°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyladipoyl Dichloride |