Online Database of Chemicals from Around the World
|
CAS#: 68178-51-8 Product: 3,4-Dihydro-2,5,7-Trihydroxy-3-Methoxy-2-Methyl-1,6,11(2H)-Naphthacenetrione No suppilers available for the product. |
| Name | 3,4-Dihydro-2,5,7-Trihydroxy-3-Methoxy-2-Methyl-1,6,11(2H)-Naphthacenetrione |
|---|---|
| Synonyms | 1,6,11(2H)-Naphthacenetrione, 3,4-Dihydro-2,5,7-Trihydroxy-3-Methoxy-2-Methyl-; 3-Methoxy-2-Methyl-2,5,7-Trihydroxy-3,4-Dihydro-1,6,11(2H)-Naphthacenetrione; Antibiotic Sm 173B |
| Molecular Structure |  |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 |
| CAS Registry Number | 68178-51-8 |
| SMILES | C1=C3C(=C(O)C2=C1C(=O)C(O)(C(OC)C2)C)C(=O)C4=C(C3=O)C=CC=C4O |
| InChI | 1S/C20H16O7/c1-20(26)13(27-2)7-9-10(19(20)25)6-11-15(17(9)23)18(24)14-8(16(11)22)4-3-5-12(14)21/h3-6,13,21,23,26H,7H2,1-2H3 |
| InChIKey | JYDSLMCACANRIN-UHFFFAOYSA-N |
| Density | 1.596g/cm3 (Cal.) |
|---|---|
| Boiling point | 665.44°C at 760 mmHg (Cal.) |
| Flash point | 243.376°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-2,5,7-Trihydroxy-3-Methoxy-2-Methyl-1,6,11(2H)-Naphthacenetrione |