|
CAS#: 682-70-2 Product: Phosphoric Acid Diethyl 5,5,5-Trichloropentyl Ester No suppilers available for the product. |
| Name | Phosphoric Acid Diethyl 5,5,5-Trichloropentyl Ester |
|---|---|
| Synonyms | Phosphoric Acid Diethyl 5,5,5-Trichloropentyl Ester; Brn 1819962; Diethyl Trichloropentyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Cl3O4P |
| Molecular Weight | 327.57 |
| CAS Registry Number | 682-70-2 |
| SMILES | C(O[P](OCC)(=O)OCCCCC(Cl)(Cl)Cl)C |
| InChI | 1S/C9H18Cl3O4P/c1-3-14-17(13,15-4-2)16-8-6-5-7-9(10,11)12/h3-8H2,1-2H3 |
| InChIKey | MKFXNOLLLTYMRD-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.024°C at 760 mmHg (Cal.) |
| Flash point | 247.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid Diethyl 5,5,5-Trichloropentyl Ester |