|
CAS#: 6827-31-2 Product: 1,2-Dihydro-Cyclobuta[b]Naphthalene No suppilers available for the product. |
| Name | 1,2-Dihydro-Cyclobuta[b]Naphthalene |
|---|---|
| Synonyms | Cyclobuta[B]Naphthalene,1,2-Dihydro-; Cyclobuta(B)Naphthalene, 1,2-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 6827-31-2 |
| SMILES | C1=C2C(=CC=C1)C=C3C(=C2)CC3 |
| InChI | 1S/C12H10/c1-2-4-10-8-12-6-5-11(12)7-9(10)3-1/h1-4,7-8H,5-6H2 |
| InChIKey | MMABYPJZIOSXLX-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.451°C at 760 mmHg (Cal.) |
| Flash point | 131.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydro-Cyclobuta[b]Naphthalene |