|
CAS#: 6822-47-5 Product: Sophoradiol No suppilers available for the product. |
| Name | Sophoradiol |
|---|---|
| Synonyms | Aids-098133; Aids098133; Olean-12-Ene-3.Beta.,22.Beta.-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.72 |
| CAS Registry Number | 6822-47-5 |
| SMILES | [C@]25(C(=CCC3[C@]1(CC[C@@H](C(C1CC[C@@]23C)(C)C)O)C)C4CC(C)(C)C[C@H]([C@@]4(CC5)C)O)C |
| InChI | 1S/C30H50O2/c1-25(2)17-20-19-9-10-22-28(6)13-12-23(31)26(3,4)21(28)11-14-30(22,8)29(19,7)16-15-27(20,5)24(32)18-25/h9,20-24,31-32H,10-18H2,1-8H3/t20?,21?,22?,23-,24+,27+,28-,29+,30+/m0/s1 |
| InChIKey | ZEGUWBQDYDXBNS-CVPOBCMLSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.684°C at 760 mmHg (Cal.) |
| Flash point | 210.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sophoradiol |