|
CAS#: 68227-99-6 Product: 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Acrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Butyl Ester; Acrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Butyl Ester; 2-Propenoic Acid, 4-(Methyl((Undecafluoropentyl)Sulfonyl)Amino)Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F11NO4S |
| Molecular Weight | 489.30 |
| CAS Registry Number | 68227-99-6 |
| EINECS | 269-395-7 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C=C |
| InChI | 1S/C13H14F11NO4S/c1-3-8(26)29-7-5-4-6-25(2)30(27,28)13(23,24)11(18,19)9(14,15)10(16,17)12(20,21)22/h3H,1,4-7H2,2H3 |
| InChIKey | IGHHYZVIDWXKMF-UHFFFAOYSA-N |
| Density | 1.482g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.7°C at 760 mmHg (Cal.) |
| Flash point | 161.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Acrylate |