|
CAS#: 68239-77-0 Product: 1,4-Bis[(2,4-Dimethylphenyl)Amino]Anthraquinone No suppilers available for the product. |
| Name | 1,4-Bis[(2,4-Dimethylphenyl)Amino]Anthraquinone |
|---|---|
| Synonyms | 1,4-Bis[(2,4-Dimethylphenyl)Amino]-9,10-Anthraquinone; 1,4-Bis((2,4-Dimethylphenyl)Amino)Anthraquinone; 1,4-Di(2',4'-Dimethylphenylamino)Anthracene-9,10-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 |
| CAS Registry Number | 68239-77-0 |
| EINECS | 269-470-4 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=CC=C3NC4=CC=C(C=C4C)C)NC5=CC=C(C=C5C)C |
| InChI | 1S/C30H26N2O2/c1-17-9-11-23(19(3)15-17)31-25-13-14-26(32-24-12-10-18(2)16-20(24)4)28-27(25)29(33)21-7-5-6-8-22(21)30(28)34/h5-16,31-32H,1-4H3 |
| InChIKey | CKAHGQQRLOXOEF-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.772°C at 760 mmHg (Cal.) |
| Flash point | 182.553°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis[(2,4-Dimethylphenyl)Amino]Anthraquinone |