|
CAS#: 68258-90-2 Product: Heptachlorocyclopentane No suppilers available for the product. |
| Name | Heptachlorocyclopentane |
|---|---|
| Synonyms | Cyclopentane, Heptachloro-; Heptachlorocyclopentane |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3Cl7 |
| Molecular Weight | 311.25 |
| CAS Registry Number | 68258-90-2 |
| EINECS | 269-496-6 |
| SMILES | C1(C(C(C(C1(Cl)Cl)Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C5H3Cl7/c6-1-2(7)5(11,12)3(8)4(1,9)10/h1-3H |
| InChIKey | XCEUTYGYMGYCBG-UHFFFAOYSA-N |
| Density | 1.762g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.823°C at 760 mmHg (Cal.) |
| Flash point | 133.67°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptachlorocyclopentane |