|
CAS#: 68258-91-3 Product: Hexachlorocyclopentane No suppilers available for the product. |
| Name | Hexachlorocyclopentane |
|---|---|
| Synonyms | Cyclopentane, Hexachloro-; Hexachlorocyclopentane |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4Cl6 |
| Molecular Weight | 276.80 |
| CAS Registry Number | 68258-91-3 |
| EINECS | 269-497-1 |
| SMILES | C1C(C(C(C1Cl)(Cl)Cl)Cl)(Cl)Cl |
| InChI | 1S/C5H4Cl6/c6-2-1-4(8,9)3(7)5(2,10)11/h2-3H,1H2 |
| InChIKey | RPUFWOAXMFQSDJ-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.149°C at 760 mmHg (Cal.) |
| Flash point | 125.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexachlorocyclopentane |