|
CAS#: 68259-14-3 Product: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-N-Methylheptane-1-Sulphonamide No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-N-Methylheptane-1-Sulphonamide |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-N-Methyl-Heptane-1-Sulfonamide; Pentadecafluoro-N-Methyl-1-Heptanesulfonamide; 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-N-Methylheptane-1-Sulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4F15NO2S |
| Molecular Weight | 463.16 |
| CAS Registry Number | 68259-14-3 |
| EINECS | 269-515-8 |
| SMILES | CN[S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C8H4F15NO2S/c1-24-27(25,26)8(22,23)6(17,18)4(13,14)2(9,10)3(11,12)5(15,16)7(19,20)21/h24H,1H3 |
| InChIKey | KDHCALLFPWZTPN-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.014°C at 760 mmHg (Cal.) |
| Flash point | 81.419°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-N-Methylheptane-1-Sulphonamide |