|
CAS#: 68298-06-6 Product: 2-[Ethyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate No suppilers available for the product. |
| Name | 2-[Ethyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2-(Ethyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Ethyl Ester; Acrylic Acid 2-(Ethyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12F11NO4S |
| Molecular Weight | 475.27 |
| CAS Registry Number | 68298-06-6 |
| EINECS | 269-538-3 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCOC(=O)C=C)C |
| InChI | 1S/C12H12F11NO4S/c1-3-7(25)28-6-5-24(4-2)29(26,27)12(22,23)10(17,18)8(13,14)9(15,16)11(19,20)21/h3H,1,4-6H2,2H3 |
| InChIKey | ZCIQIKYETQVARM-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.889°C at 760 mmHg (Cal.) |
| Flash point | 152.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Ethyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate |