Online Database of Chemicals from Around the World
|
CAS#: 68298-09-9 Product: N-Benzyl-1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-Hexane-1-Sulfonamide No suppilers available for the product. |
| Name | N-Benzyl-1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-Hexane-1-Sulfonamide |
|---|---|
| Synonyms | N-(Benzyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-Hexane-1-Sulfonamide; 1-Hexanesulfonamide, 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-N-(Phenylmethyl)-; N-(Phenylmethyl)Perfluorohexanesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C13H8F13NO2S |
| Molecular Weight | 489.25 |
| CAS Registry Number | 68298-09-9 |
| SMILES | C1=CC=C(C=C1)CN[S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C13H8F13NO2S/c14-8(15,10(18,19)12(22,23)24)9(16,17)11(20,21)13(25,26)30(28,29)27-6-7-4-2-1-3-5-7/h1-5,27H,6H2 |
| InChIKey | ZEIOJAPXFDPENM-UHFFFAOYSA-N |
| Density | 1.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.212°C at 760 mmHg (Cal.) |
| Flash point | 147.459°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-Hexane-1-Sulfonamide |