|
CAS#: 68360-59-8 Product: 1-Chloro-4-[(4-Nitrophenoxy)Methylsulfonyl]Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-[(4-Nitrophenoxy)Methylsulfonyl]Benzene |
|---|---|
| Synonyms | Nsc320313 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClNO5S |
| Molecular Weight | 327.74 |
| CAS Registry Number | 68360-59-8 |
| SMILES | C1=C(C=CC(=C1)OC[S](C2=CC=C(C=C2)Cl)(=O)=O)[N+]([O-])=O |
| InChI | 1S/C13H10ClNO5S/c14-10-1-7-13(8-2-10)21(18,19)9-20-12-5-3-11(4-6-12)15(16)17/h1-8H,9H2 |
| InChIKey | HLMUNTISFOMKSW-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.677°C at 760 mmHg (Cal.) |
| Flash point | 291.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[(4-Nitrophenoxy)Methylsulfonyl]Benzene |