|
CAS#: 68398-21-0 Product: Manganese Bis(Dimethylhexanoate) No suppilers available for the product. |
| Name | Manganese Bis(Dimethylhexanoate) |
|---|---|
| Synonyms | Manganous 2,2-Dimethylhexanoate; Hexanoic Acid, Dimethyl-, Manganese(2+) Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C16H30MnO4 |
| Molecular Weight | 341.35 |
| CAS Registry Number | 68398-21-0 |
| EINECS | 269-972-3 |
| SMILES | C(C(C([O-])=O)(C)C)CCC.C(C(C([O-])=O)(C)C)CCC.[Mn++] |
| InChI | 1S/2C8H16O2.Mn/c2*1-4-5-6-8(2,3)7(9)10;/h2*4-6H2,1-3H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | KEALCUZTPRMWSR-UHFFFAOYSA-L |
| Boiling point | 227.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese Bis(Dimethylhexanoate) |