|
CAS#: 68441-30-5 Product: 1,2-Diethenylbenzene-N,N-Dimethylmethanamine-Styrene Polymer No suppilers available for the product. |
| Name | 1,2-Diethenylbenzene-N,N-Dimethylmethanamine-Styrene Polymer |
|---|---|
| Synonyms | N,N-Dimethylmethanamine; 1,2-Divinylbenzene; Styrene; 1,2-Divinylbenzene; Styrene; Trimethylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 |
| CAS Registry Number | 68441-30-5 |
| SMILES | CN(C)C.C1=C(C(=CC=C1)C=C)C=C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C10H10.C8H8.C3H9N/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;1-4(2)3/h3-8H,1-2H2;2-7H,1H2;1-3H3 |
| InChIKey | BPHVLQRXIFMAKK-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Diethenylbenzene-N,N-Dimethylmethanamine-Styrene Polymer |