|
CAS#: 68555-72-6 Product: N-Ethyl-1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-(2-Hydroxyethyl)Pentane-1-Sulphonamide No suppilers available for the product. |
| Name | N-Ethyl-1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-(2-Hydroxyethyl)Pentane-1-Sulphonamide |
|---|---|
| Synonyms | 1-Pentanesulfonamide, N-Ethyl-1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-(2-Hydroxyethyl)-; N-Ethyl-1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-(2-Hydroxyethyl)Pentane-1-Sulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10F11NO3S |
| Molecular Weight | 421.23 |
| CAS Registry Number | 68555-72-6 |
| EINECS | 271-450-5 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCO)C |
| InChI | 1S/C9H10F11NO3S/c1-2-21(3-4-22)25(23,24)9(19,20)7(14,15)5(10,11)6(12,13)8(16,17)18/h22H,2-4H2,1H3 |
| InChIKey | GBPAQIZWHVCENQ-UHFFFAOYSA-N |
| Density | 1.601g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.508°C at 760 mmHg (Cal.) |
| Flash point | 122.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-(2-Hydroxyethyl)Pentane-1-Sulphonamide |