|
CAS#: 68612-45-3 Product: 2-Methylbutanoic acid 2,3,3a,4,8,9,10,12a-octahydro-11-(hydroxymethyl)-3-methylene-2,6-dioxo-6H-4,7-methenofuro(3,2-c)oxacycloundecin-8-yl ester No suppilers available for the product. |
| Name | 2-Methylbutanoic acid 2,3,3a,4,8,9,10,12a-octahydro-11-(hydroxymethyl)-3-methylene-2,6-dioxo-6H-4,7-methenofuro(3,2-c)oxacycloundecin-8-yl ester |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 |
| CAS Registry Number | 68612-45-3 |
| SMILES | C(O)/C3=C/C1OC(=O)C(C1C2OC(=O)C(=C2)C(OC(=O)C(CC)C)CC3)=C |
| InChI | 1S/C20H24O7/c1-4-10(2)18(22)25-14-6-5-12(9-21)7-15-17(11(3)19(23)26-15)16-8-13(14)20(24)27-16/h7-8,10,14-17,21H,3-6,9H2,1-2H3/b12-7+ |
| InChIKey | PUJGIZDDMGEBCG-KPKJPENVSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 636.867°C at 760 mmHg (Cal.) |
| Flash point | 227.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylbutanoic acid 2,3,3a,4,8,9,10,12a-octahydro-11-(hydroxymethyl)-3-methylene-2,6-dioxo-6H-4,7-methenofuro(3,2-c)oxacycloundecin-8-yl ester |