|
CAS#: 68690-90-4 Product: N-Nitroso-N-Methyl-2-(2-Phenyl)-Propylamine No suppilers available for the product. |
| Name | N-Nitroso-N-Methyl-2-(2-Phenyl)-Propylamine |
|---|---|
| Synonyms | N-Methyl-N-(1-Methyl-1-Phenyl-Ethyl)Nitrous Amide; N-Methyl-N-(1-Methyl-1-Phenylethyl)Nitrous Amide; Benzylamine, N-Nitroso-Alpha,Alpha,N-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 |
| CAS Registry Number | 68690-90-4 |
| SMILES | C1=CC=CC=C1C(N(N=O)C)(C)C |
| InChI | 1S/C10H14N2O/c1-10(2,12(3)11-13)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | BPBDCNHXICBGIK-UHFFFAOYSA-N |
| Density | 0.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.185°C at 760 mmHg (Cal.) |
| Flash point | 139.581°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso-N-Methyl-2-(2-Phenyl)-Propylamine |