Online Database of Chemicals from Around the World
| Name | 3-(Isopropyl)-1,1,2,6-Tetramethylindan |
|---|---|
| Synonyms | 3-Isopropyl-1,1,2,6-Tetramethyl-Indane; 3-Isopropyl-1,1,2,6-Tetramethylindane; 3-(Isopropyl)-1,1,2,6-Tetramethylindan |
| Molecular Structure |  |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 |
| CAS Registry Number | 68857-84-1 |
| EINECS | 272-514-5 |
| SMILES | C1=C(C=CC2=C1C(C(C2C(C)C)C)(C)C)C |
| InChI | 1S/C16H24/c1-10(2)15-12(4)16(5,6)14-9-11(3)7-8-13(14)15/h7-10,12,15H,1-6H3 |
| InChIKey | JLVMQRKTHPQUBM-UHFFFAOYSA-N |
| Density | 0.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.381°C at 760 mmHg (Cal.) |
| Flash point | 119.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Isopropyl)-1,1,2,6-Tetramethylindan |
