|
CAS#: 68921-89-1 Product: 4-(Methoxymethyl)Benzophenone No suppilers available for the product. |
| Name | 4-(Methoxymethyl)Benzophenone |
|---|---|
| Synonyms | [4-(Methoxymethyl)Phenyl]-Phenyl-Methanone; Methanone, (4-(Methoxymethyl)Phenyl)Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 68921-89-1 |
| EINECS | 272-965-8 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)COC |
| InChI | 1S/C15H14O2/c1-17-11-12-7-9-14(10-8-12)15(16)13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | NLNLATCMOFUMFV-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.106°C at 760 mmHg (Cal.) |
| Flash point | 147.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Methoxymethyl)Benzophenone |