Online Database of Chemicals from Around the World
|
CAS#: 68930-33-6 Product: 3,3,5,5-Tetramethyllimonene No suppilers available for the product. |
| Name | 3,3,5,5-Tetramethyllimonene |
|---|---|
| Synonyms | 4-Isopropenyl-1,3,3,5,5-Pentamethyl-Cyclohexene; 4-Isopropenyl-1,3,3,5,5-Pentamethylcyclohexene; 1,3,3,5,5-Pentamethyl-4-Prop-1-En-2-Yl-Cyclohexene |
| Molecular Structure |  |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.34 |
| CAS Registry Number | 68930-33-6 |
| SMILES | CC1(C(C(CC(=C1)C)(C)C)C(=C)C)C |
| InChI | 1S/C14H24/c1-10(2)12-13(4,5)8-11(3)9-14(12,6)7/h8,12H,1,9H2,2-7H3 |
| InChIKey | GXATYSZBKVMODG-UHFFFAOYSA-N |
| Density | 0.801g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.594°C at 760 mmHg (Cal.) |
| Flash point | 83.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,5,5-Tetramethyllimonene |