|
CAS#: 68958-53-2 Product: 1-Isooctyl-4-(4-Nitrophenoxy)Benzene No suppilers available for the product. |
| Name | 1-Isooctyl-4-(4-Nitrophenoxy)Benzene |
|---|---|
| Synonyms | 4-Nitro-4'-Isooctyldiphenyl Ether; Benzene, 1-Isooctyl-4-(4-Nitrophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 |
| CAS Registry Number | 68958-53-2 |
| EINECS | 273-372-7 |
| SMILES | C1=CC(=CC=C1CCCCCC(C)C)OC2=CC=C(C=C2)[N+]([O-])=O |
| InChI | 1S/C20H25NO3/c1-16(2)6-4-3-5-7-17-8-12-19(13-9-17)24-20-14-10-18(11-15-20)21(22)23/h8-16H,3-7H2,1-2H3 |
| InChIKey | JGJYBIMETXRNKX-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.493°C at 760 mmHg (Cal.) |
| Flash point | 149.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isooctyl-4-(4-Nitrophenoxy)Benzene |