|
CAS#: 69011-49-0 Product: Ethenylbenzene, ethyleneglycol dimethacrylate polymer, N,N,N-trimethylmethanaminium hydroxide No suppilers available for the product. |
| Name | Ethenylbenzene, ethyleneglycol dimethacrylate polymer, N,N,N-trimethylmethanaminium hydroxide |
|---|---|
| Synonyms | Dimethylaminomethanol; 2-Methylprop-2-Enoic Acid 2-(2-Methyl-1-Oxoprop-2-Enoxy)Ethyl Ester; Styrene; Dimethylaminomethanol; 2-Methylacrylic Acid 2-Methacryloyloxyethyl Ester; Styrene |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 |
| CAS Registry Number | 69011-49-0 |
| SMILES | C(OC(=O)C(=C)C)COC(=O)C(=C)C.C(O)N(C)C.C1=C(C=CC=C1)C=C |
| InChI | 1S/C10H14O4.C8H8.C3H9NO/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-2-8-6-4-3-5-7-8;1-4(2)3-5/h1,3,5-6H2,2,4H3;2-7H,1H2;5H,3H2,1-2H3 |
| InChIKey | RNRCGAPPKMXACN-UHFFFAOYSA-N |
| Boiling point | 260.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethenylbenzene, ethyleneglycol dimethacrylate polymer, N,N,N-trimethylmethanaminium hydroxide |