|
CAS#: 6903-65-7 Product: 2,4-Dichlorodiphenyl ether (2,4'-Dichloroisomer) No suppilers available for the product. |
| Name | 2,4-Dichlorodiphenyl ether (2,4'-Dichloroisomer) |
|---|---|
| Synonyms | 2,4'-Dichlorodiphenyl Ether; Benzene, 1-Chloro-2-(4-Chlorophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.10 |
| CAS Registry Number | 6903-65-7 |
| SMILES | C1=CC(=CC=C1Cl)OC2=C(C=CC=C2)Cl |
| InChI | 1S/C12H8Cl2O/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8H |
| InChIKey | MWKULKMSBBSGTP-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.926°C at 760 mmHg (Cal.) |
| Flash point | 86.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichlorodiphenyl ether (2,4'-Dichloroisomer) |