|
CAS#: 69140-06-3 Product: Cholest-8(14)-Ene-3,7-Diol No suppilers available for the product. |
| Name | Cholest-8(14)-Ene-3,7-Diol |
|---|---|
| Synonyms | (3S,5R,7R,9R,10S,13R,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthrene-3,7-Diol; 5-Cediol; 5Alpha-Cholest-8(14)-Ene-3Beta,7Alpha-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 |
| CAS Registry Number | 69140-06-3 |
| SMILES | [C@@H]13[C@@]4([C@@H](C[C@@H](O)C1=C2[C@@]([C@H](CC2)[C@@H](CCCC(C)C)C)(CC3)C)C[C@@H](O)CC4)C |
| InChI | 1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h17-21,23-24,28-29H,6-16H2,1-5H3/t18-,19-,20+,21-,23+,24-,26+,27-/m1/s1 |
| InChIKey | GSHNIZXJELCQAO-ZWECLWEZSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.714°C at 760 mmHg (Cal.) |
| Flash point | 214.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cholest-8(14)-Ene-3,7-Diol |