|
CAS#: 69226-52-4 Product: 4,4'-(Thiobisimino)Bis(Benzenesulfonamide) No suppilers available for the product. |
| Name | 4,4'-(Thiobisimino)Bis(Benzenesulfonamide) |
|---|---|
| Synonyms | 4-[[[(4-Sulfamoylphenyl)Amino]Thio]Amino]Benzenesulfonamide; Bis 4,4'-Thio Sulfonamide; Sulfanilamide, N(Sup 4),N(Sup 4')-Thiodi- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N4O4S3 |
| Molecular Weight | 374.45 |
| CAS Registry Number | 69226-52-4 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)N)NSNC2=CC=C(C=C2)[S](=O)(=O)N |
| InChI | 1S/C12H14N4O4S3/c13-22(17,18)11-5-1-9(2-6-11)15-21-16-10-3-7-12(8-4-10)23(14,19)20/h1-8,15-16H,(H2,13,17,18)(H2,14,19,20) |
| InChIKey | ROPZPUBAWDVKOQ-UHFFFAOYSA-N |
| Density | 1.642g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.319°C at 760 mmHg (Cal.) |
| Flash point | 336.215°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-(Thiobisimino)Bis(Benzenesulfonamide) |