|
CAS#: 69289-32-3 Product: Periplanone A No suppilers available for the product. |
| Name | Periplanone A |
|---|---|
| Synonyms | 1,2,3,7,8,8A-Hexahydro-8-Methylene-2-(1-Methylethyl)-4H-1,4A-(Epoxymethano)Naphthalen-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 69289-32-3 |
| SMILES | CC(C3C1OCC2(C1C(CC=C2)=C)C(=O)C3)C |
| InChI | 1S/C15H20O2/c1-9(2)11-7-12(16)15-6-4-5-10(3)13(15)14(11)17-8-15/h4,6,9,11,13-14H,3,5,7-8H2,1-2H3 |
| InChIKey | TYWRMTYJLKIUFN-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.962°C at 760 mmHg (Cal.) |
| Flash point | 152.423°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Periplanone A |