| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3S,4S,5R,6S,7R)-1-Oxaspiro[2.5]octane-4,5,6,7-tetrol |
|---|---|
| Synonyms | (3S,4S,5R,6S,7R)-1-oxaspiro[2.5]octane-4,5,6,7-tetraol; (3S,4S,5R,6S,7R)-4,5,6,7-Tetrahydroxy-1-oxaspiro[2,5]octane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 |
| CAS Registry Number | 693245-36-2 |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H]([C@@]12CO2)O)O)O)O |
| InChI | 1S/C7H12O5/c8-3-1-7(2-12-7)6(11)5(10)4(3)9/h3-6,8-11H,1-2H2/t3-,4+,5-,6+,7+/m1/s1 |
| InChIKey | PTOFPGOUNMCBOR-UOYQFSTFSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 175.1±27.9°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| (1) | Seiichiro Ogawa, Yo Ohishi, Miwako Asada, Akihiro Tomoda, Atsushi Takahashi, Yoriko Ooki, Midori Mori, Masayoshi Itoh and Takashi Korenaga. Convenient synthesis of (+)-valiolamine and (−)-1-epi-valiolamine from (−)-vibo-quercitol, Org. Biomol. Chem., 2004, 2, 884. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3S,4S,5R,6S,7R)-1-Oxaspiro[2.5]octane-4,5,6,7-tetrol |