|
CAS#: 693285-71-1 Product: 4-Bromo-3-isopropyl-1H-indazole No suppilers available for the product. |
| Name | 4-Bromo-3-isopropyl-1H-indazole |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.11 |
| CAS Registry Number | 693285-71-1 |
| SMILES | CC(C)C1=NNC2=C1C(=CC=C2)Br |
| InChI | 1S/C10H11BrN2/c1-6(2)10-9-7(11)4-3-5-8(9)12-13-10/h3-6H,1-2H3,(H,12,13) |
| InChIKey | XEXVOZFTCDGRDR-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.8±22.0°C at 760 mmHg (Cal.) |
| Flash point | 162.9±22.3°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-3-isopropyl-1H-indazole |