|
CAS#: 69340-56-3 Product: 2,5-Dimethyl-2-(3-methyl-2-buten-1-yl)-4-hexenenitrile No suppilers available for the product. |
| Name | 2,5-Dimethyl-2-(3-methyl-2-buten-1-yl)-4-hexenenitrile |
|---|---|
| Synonyms | 2,5-Dimethyl-2-(3-methyl-2-butenyl)-4-hexenenitrile; 2,5-Dimethyl-2-(3-methyl-2-butenyl)-4-hexenenitrile # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.31 |
| CAS Registry Number | 69340-56-3 |
| SMILES | N#CC(C/C=C(\C)C)(C/C=C(/C)C)C |
| InChI | 1S/C13H21N/c1-11(2)6-8-13(5,10-14)9-7-12(3)4/h6-7H,8-9H2,1-5H3 |
| InChIKey | URTASEATTPRTMJ-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.021°C at 760 mmHg (Cal.) |
| Flash point | 139.201°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-2-(3-methyl-2-buten-1-yl)-4-hexenenitrile |