Online Database of Chemicals from Around the World
|
CAS#: 6935-45-1 Product: 4-Amino-N-(2-Aminoethyl)Benzenesulfonamide No suppilers available for the product. |
| Name | 4-Amino-N-(2-Aminoethyl)Benzenesulfonamide |
|---|---|
| Synonyms | 4-Amino-N-(2-Aminoethyl)Benzenesulfonamide; Ncgc00013494; Nsc-42167 |
| Molecular Structure |  |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.27 |
| CAS Registry Number | 6935-45-1 |
| SMILES | C1=C([S](NCCN)(=O)=O)C=CC(=C1)N |
| InChI | 1S/C8H13N3O2S/c9-5-6-11-14(12,13)8-3-1-7(10)2-4-8/h1-4,11H,5-6,9-10H2 |
| InChIKey | NBFKPKDIBNOBEP-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.953°C at 760 mmHg (Cal.) |
| Flash point | 209.595°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-(2-Aminoethyl)Benzenesulfonamide |