|
CAS#: 6935-75-7 Product: 1,3-Diphenyl-2-Bromo-2-Propene-1-One No suppilers available for the product. |
| Name | 1,3-Diphenyl-2-Bromo-2-Propene-1-One |
|---|---|
| Synonyms | 2-Bromo-1,3-Di(Phenyl)Prop-2-En-1-One; Nsc167201; .Alpha.-Bromochalcone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11BrO |
| Molecular Weight | 287.16 |
| CAS Registry Number | 6935-75-7 |
| SMILES | C1=CC=CC=C1C(\C(=C\C2=CC=CC=C2)Br)=O |
| InChI | 1S/C15H11BrO/c16-14(11-12-7-3-1-4-8-12)15(17)13-9-5-2-6-10-13/h1-11H/b14-11- |
| InChIKey | KRLKFHWRCHJJGA-KAMYIIQDSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.55°C at 760 mmHg (Cal.) |
| Flash point | 71.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diphenyl-2-Bromo-2-Propene-1-One |