|
CAS#: 6938-28-9 Product: N-(2-Acetyl-5-Chloro-Phenyl)Formamide No suppilers available for the product. |
| Name | N-(2-Acetyl-5-Chloro-Phenyl)Formamide |
|---|---|
| Synonyms | N-(2-Acetyl-5-Chloro-Phenyl)Formamide; N-(5-Chloro-2-Ethanoyl-Phenyl)Methanamide; Nsc53942 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 |
| CAS Registry Number | 6938-28-9 |
| SMILES | C1=CC(=CC(=C1C(=O)C)NC=O)Cl |
| InChI | 1S/C9H8ClNO2/c1-6(13)8-3-2-7(10)4-9(8)11-5-12/h2-5H,1H3,(H,11,12) |
| InChIKey | YEBUBZSFNBNBET-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.298°C at 760 mmHg (Cal.) |
| Flash point | 204.36°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Acetyl-5-Chloro-Phenyl)Formamide |