|
CAS#: 6938-33-6 Product: Propyl 3-(3-Furyl)Acrylate No suppilers available for the product. |
| Name | Propyl 3-(3-Furyl)Acrylate |
|---|---|
| Synonyms | Propyl (E)-3-Furan-3-Ylprop-2-Enoate; Propyl 3-(3-Furyl)Prop-2-Enoate; Propyl (E)-3-(3-Furyl)Prop-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 6938-33-6 |
| EINECS | 230-067-3 |
| SMILES | C1=C(/C=C/C(=O)OCCC)C=CO1 |
| InChI | 1S/C10H12O3/c1-2-6-13-10(11)4-3-9-5-7-12-8-9/h3-5,7-8H,2,6H2,1H3/b4-3+ |
| InChIKey | NKJKUMDOQWJRSH-ONEGZZNKSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.71°C at 760 mmHg (Cal.) |
| Flash point | 110.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propyl 3-(3-Furyl)Acrylate |