|
CAS#: 6940-83-6 Product: 1-Chloro-4-(3-Chloro-1-Ethoxypropyl)Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(3-Chloro-1-Ethoxypropyl)Benzene |
|---|---|
| Synonyms | 1-Chloro-4-(3-Chloro-1-Ethoxy-Propyl)Benzene; Nsc60404 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 |
| CAS Registry Number | 6940-83-6 |
| EINECS | 230-091-4 |
| SMILES | C1=C(C(OCC)CCCl)C=CC(=C1)Cl |
| InChI | 1S/C11H14Cl2O/c1-2-14-11(7-8-12)9-3-5-10(13)6-4-9/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | KRIHHRGWTCCRDL-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.033°C at 760 mmHg (Cal.) |
| Flash point | 60.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(3-Chloro-1-Ethoxypropyl)Benzene |