|
CAS#: 69418-53-7 Product: Heptabromo-9H-Fluorene No suppilers available for the product. |
| Name | Heptabromo-9H-Fluorene |
|---|---|
| Synonyms | Heptabromo-9H-Fluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H3Br7 |
| Molecular Weight | 718.49 |
| CAS Registry Number | 69418-53-7 |
| EINECS | 273-993-3 |
| SMILES | C1=CC2=C(C(=C1Br)Br)C3=C(C2Br)C(=C(Br)C(=C3Br)Br)Br |
| InChI | 1S/C13H3Br7/c14-4-2-1-3-5(9(4)16)6-7(8(3)15)11(18)13(20)12(19)10(6)17/h1-2,8H |
| InChIKey | MAHYQWMRBATAGD-UHFFFAOYSA-N |
| Density | 2.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.027°C at 760 mmHg (Cal.) |
| Flash point | 270.935°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptabromo-9H-Fluorene |