|
CAS#: 69466-77-9 Product: 5-(3,4-Dimethoxyphenyl)-3-Methoxy-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(3,4-Dimethoxyphenyl)-3-Methoxy-1,2,4-Triazine |
|---|---|
| Synonyms | As-Triazine, 5-(3,4-Dimethoxyphenyl)-3-Methoxy-; 1,2,4-Triazine, 5-(3,4-Dimethoxyphenyl)-3-Methoxy-; 5-(3,4-Dimethoxyphenyl)-3-Methoxy-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 |
| CAS Registry Number | 69466-77-9 |
| SMILES | C1=C(N=C(N=N1)OC)C2=CC=C(C(=C2)OC)OC |
| InChI | 1S/C12H13N3O3/c1-16-10-5-4-8(6-11(10)17-2)9-7-13-15-12(14-9)18-3/h4-7H,1-3H3 |
| InChIKey | WBFFJDMOZXSWFZ-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 404°C at 760 mmHg (Cal.) |
| Flash point | 146.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3,4-Dimethoxyphenyl)-3-Methoxy-1,2,4-Triazine |