|
CAS#: 69466-96-2 Product: 5-(4-Ethylphenyl)-3-Methylthio-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(4-Ethylphenyl)-3-Methylthio-1,2,4-Triazine |
|---|---|
| Synonyms | 5-(4-Ethylphenyl)-3-(Methylthio)-1,2,4-Triazine; 1,2,4-Triazine, 5-(4-Ethylphenyl)-3-(Methylthio)-; 5-(P-Ethylphenyl)-3-(Methylthio)-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.31 |
| CAS Registry Number | 69466-96-2 |
| SMILES | C1=C(N=C(N=N1)SC)C2=CC=C(C=C2)CC |
| InChI | 1S/C12H13N3S/c1-3-9-4-6-10(7-5-9)11-8-13-15-12(14-11)16-2/h4-8H,3H2,1-2H3 |
| InChIKey | WSGQMVHBDDOGRC-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.057°C at 760 mmHg (Cal.) |
| Flash point | 207.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Ethylphenyl)-3-Methylthio-1,2,4-Triazine |