|
CAS#: 69467-21-6 Product: 5,6-Diphenyl-3-Isopropoxy-1,2,4-Triazine No suppilers available for the product. |
| Name | 5,6-Diphenyl-3-Isopropoxy-1,2,4-Triazine |
|---|---|
| Synonyms | 3-Isopropoxy-5,6-Di(Phenyl)-1,2,4-Triazine; 1,2,4-Triazine, 3-(1-Methylethoxy)-5,6-Diphenyl-; 5,6-Diphenyl-3-Isopropoxy-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 |
| CAS Registry Number | 69467-21-6 |
| SMILES | C3=C(C1=NC(=NN=C1C2=CC=CC=C2)OC(C)C)C=CC=C3 |
| InChI | 1S/C18H17N3O/c1-13(2)22-18-19-16(14-9-5-3-6-10-14)17(20-21-18)15-11-7-4-8-12-15/h3-13H,1-2H3 |
| InChIKey | VEDRKPGPRRBLMN-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.811°C at 760 mmHg (Cal.) |
| Flash point | 155.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Diphenyl-3-Isopropoxy-1,2,4-Triazine |