|
CAS#: 6949-83-3 Product: (Z)-3-[[(4-Chlorophenyl)Amino]Carbamoyl]Prop-2-Enoic Acid No suppilers available for the product. |
| Name | (Z)-3-[[(4-Chlorophenyl)Amino]Carbamoyl]Prop-2-Enoic Acid |
|---|---|
| Synonyms | (Z)-4-[N'-(4-Chlorophenyl)Hydrazino]-4-Oxo-But-2-Enoic Acid; (Z)-4-[N'-(4-Chlorophenyl)Hydrazino]-4-Oxobut-2-Enoic Acid; (Z)-4-[N'-(4-Chlorophenyl)Hydrazino]-4-Keto-But-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 |
| CAS Registry Number | 6949-83-3 |
| SMILES | C1=CC(=CC=C1NNC(\C=C/C(=O)O)=O)Cl |
| InChI | 1S/C10H9ClN2O3/c11-7-1-3-8(4-2-7)12-13-9(14)5-6-10(15)16/h1-6,12H,(H,13,14)(H,15,16)/b6-5- |
| InChIKey | WGHZQRRNBDIYCR-WAYWQWQTSA-N |
| Density | 1.463g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.561°C at 760 mmHg (Cal.) |
| Flash point | 182.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-3-[[(4-Chlorophenyl)Amino]Carbamoyl]Prop-2-Enoic Acid |