|
CAS#: 69504-37-6 Product: N-(5-Chloro-1,2-benzisothiazol-3-yl)acetamide No suppilers available for the product. |
| Name | N-(5-Chloro-1,2-benzisothiazol-3-yl)acetamide |
|---|---|
| Synonyms | N-(5-Chloro-1,2-Benzothiazol-3-Yl)Ethanamide; Acetamide, N-(5-Chloro-1,2-Benzisothiazol-3-Yl)-; N-(5-Chloro-1,2-Benzisothiazol-3-Yl)Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.68 |
| CAS Registry Number | 69504-37-6 |
| SMILES | C1=C(Cl)C=CC2=C1C(=NS2)NC(=O)C |
| InChI | 1S/C9H7ClN2OS/c1-5(13)11-9-7-4-6(10)2-3-8(7)14-12-9/h2-4H,1H3,(H,11,12,13) |
| InChIKey | MJZBUYYWAOZKIS-UHFFFAOYSA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.417°C at 760 mmHg (Cal.) |
| Flash point | 167.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(5-Chloro-1,2-benzisothiazol-3-yl)acetamide |