|
CAS#: 6952-08-5 Product: 1-(4-Chlorophenyl)-1-Phenyl-2,2-Dichloroethane No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-1-Phenyl-2,2-Dichloroethane |
|---|---|
| Synonyms | 1-Chloro-4-(2,2-Dichloro-1-Phenyl-Ethyl)Benzene; 1,1-Dichloro-2-(P-Chlorophenyl)-2-Phenylethane; C15392 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11Cl3 |
| Molecular Weight | 285.60 |
| CAS Registry Number | 6952-08-5 |
| SMILES | C1=CC(=CC=C1Cl)C(C2=CC=CC=C2)C(Cl)Cl |
| InChI | 1S/C14H11Cl3/c15-12-8-6-11(7-9-12)13(14(16)17)10-4-2-1-3-5-10/h1-9,13-14H |
| InChIKey | WGVZTXVTROOVLN-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.424°C at 760 mmHg (Cal.) |
| Flash point | 261.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-1-Phenyl-2,2-Dichloroethane |