Online Database of Chemicals from Around the World
|
CAS#: 6958-84-5 Product: 3-Chloro-N-Phenethyl-2,4,8,9-Tetrazabicyclo[4.3.0]Nona-2,4,7,10-Tetraen-5-Amine No suppilers available for the product. |
| Name | 3-Chloro-N-Phenethyl-2,4,8,9-Tetrazabicyclo[4.3.0]Nona-2,4,7,10-Tetraen-5-Amine |
|---|---|
| Synonyms | (6-Chloro-1H-Pyrazolo[4,3-E]Pyrimidin-4-Yl)-(2-Phenylethyl)Amine; Nsc19136 |
| Molecular Structure | ![CAS#: 6958-84-5, 3-Chloro-N-Phenethyl-2,4,8,9-Tetrazabicyclo[4.3.0]Nona-2,4,7,10-Tetraen-5-Amine](/moreStructures/6958-84-5.gif) |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.72 |
| CAS Registry Number | 6958-84-5 |
| SMILES | C3=C(CCNC1=NC(=NC2=C1C=N[NH]2)Cl)C=CC=C3 |
| InChI | 1S/C13H12ClN5/c14-13-17-11(10-8-16-19-12(10)18-13)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,15,16,17,18,19) |
| InChIKey | IMEJYDFGGMCLIB-UHFFFAOYSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.693°C at 760 mmHg (Cal.) |
| Flash point | 252.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-N-Phenethyl-2,4,8,9-Tetrazabicyclo[4.3.0]Nona-2,4,7,10-Tetraen-5-Amine |