|
CAS#: 6962-75-0 Product: 6-(1-Hydrazinoethylidene)-2,4-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 6-(1-Hydrazinoethylidene)-2,4-Cyclohexadien-1-One |
|---|---|
| Synonyms | NSC54013 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 |
| CAS Registry Number | 6962-75-0 |
| SMILES | O=C\1C(=C(NN)C)\C=C/C=C/1 |
| InChI | 1S/C8H10N2O/c1-6(10-9)7-4-2-3-5-8(7)11/h2-5,10H,9H2,1H3 |
| InChIKey | MHXYHQQSNNKPEI-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.964°C at 760 mmHg (Cal.) |
| Flash point | 147.309°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1-Hydrazinoethylidene)-2,4-Cyclohexadien-1-One |