|
CAS#: 6963-24-2 Product: 2,3,5,6-Tetraphenyl-1,4-Dioxine No suppilers available for the product. |
| Name | 2,3,5,6-Tetraphenyl-1,4-Dioxine |
|---|---|
| Synonyms | Nsc53738; Zinc01684662 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H20O2 |
| Molecular Weight | 388.46 |
| CAS Registry Number | 6963-24-2 |
| SMILES | C1=CC=CC=C1C3=C(C2=CC=CC=C2)OC(=C(O3)C4=CC=CC=C4)C5=CC=CC=C5 |
| InChI | 1S/C28H20O2/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)30-28(24-19-11-4-12-20-24)27(29-25)23-17-9-3-10-18-23/h1-20H |
| InChIKey | KPABPYSZTYNHLF-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.137°C at 760 mmHg (Cal.) |
| Flash point | 211.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetraphenyl-1,4-Dioxine |