|
CAS#: 6963-55-9 Product: 2-Methylbutan-2-Yl Benzoate No suppilers available for the product. |
| Name | 2-Methylbutan-2-Yl Benzoate |
|---|---|
| Synonyms | 1,1-Dimethylpropyl Benzoate; Benzoic Acid 1,1-Dimethylpropyl Ester; Benzoic Acid Tert-Amyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 6963-55-9 |
| SMILES | C1=C(C(OC(CC)(C)C)=O)C=CC=C1 |
| InChI | 1S/C12H16O2/c1-4-12(2,3)14-11(13)10-8-6-5-7-9-10/h5-9H,4H2,1-3H3 |
| InChIKey | VAQNNXXADMWCTA-UHFFFAOYSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.254°C at 760 mmHg (Cal.) |
| Flash point | 110.402°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylbutan-2-Yl Benzoate |