|
CAS#: 6973-13-3 Product: 2-Chloro-5-Nitrotoluene-4-Sulphonic Acid No suppilers available for the product. |
| Name | 2-Chloro-5-Nitrotoluene-4-Sulphonic Acid |
|---|---|
| Synonyms | 5-Chloro-4-Methyl-2-Nitro-Benzenesulfonic Acid; 2-Chloro-5-Nitro-1-Toluene-4-Sulfonic Acid; 2-Chloro-5-Nitrotoluene-4-Sulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClNO5S |
| Molecular Weight | 251.64 |
| CAS Registry Number | 6973-13-3 |
| EINECS | 230-216-2 |
| SMILES | C1=C([S](=O)(=O)O)C(=CC(=C1Cl)C)[N+]([O-])=O |
| InChI | 1S/C7H6ClNO5S/c1-4-2-6(9(10)11)7(3-5(4)8)15(12,13)14/h2-3H,1H3,(H,12,13,14) |
| InChIKey | JTZLIGVBEAGAFZ-UHFFFAOYSA-N |
| Density | 1.653g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-Nitrotoluene-4-Sulphonic Acid |