|
CAS#: 6974-99-8 Product: 2,4,7-Trimethyl-2,3-Dihydro-1H-Indene No suppilers available for the product. |
| Name | 2,4,7-Trimethyl-2,3-Dihydro-1H-Indene |
|---|---|
| Synonyms | 2,4,7-Trimethylindane; 1H-Indene, 2,3-Dihydro-2,4,7-Trimethyl-; Nsc22053 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 6974-99-8 |
| SMILES | C2=C(C)C1=C(CC(C1)C)C(=C2)C |
| InChI | 1S/C12H16/c1-8-6-11-9(2)4-5-10(3)12(11)7-8/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | RGNDKSSUUISHGP-UHFFFAOYSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.626°C at 760 mmHg (Cal.) |
| Flash point | 91.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,7-Trimethyl-2,3-Dihydro-1H-Indene |