|
CAS#: 69915-28-2 Product: 9-Mercapto-Phenalen-1-One No suppilers available for the product. |
| Name | 9-Mercapto-Phenalen-1-One |
|---|---|
| Synonyms | 9-Mercapto-1-Phenalenone; 9-Mercaptophenalen-1-One; Phenalen-1-One,9-Mercapto- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8OS |
| Molecular Weight | 212.27 |
| CAS Registry Number | 69915-28-2 |
| SMILES | C1=CC(=C3C2=C1C=CC=C2C=CC3=O)S |
| InChI | 1S/C13H8OS/c14-10-6-4-8-2-1-3-9-5-7-11(15)13(10)12(8)9/h1-7,15H |
| InChIKey | NOWFYBYSAFRIGC-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.554°C at 760 mmHg (Cal.) |
| Flash point | 208.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Mercapto-Phenalen-1-One |